CAS 890099-01-1

[2-(Acetyloxy)phenyl](3-fluorophenyl)methanone

Description:

[2-(Acetyloxy)phenyl](3-fluorophenyl)methanone, with the CAS number 890099-01-1, is an organic compound characterized by its complex structure, which includes an acetyloxy group and a fluorophenyl moiety. This compound typically exhibits properties associated with aromatic ketones, such as stability and reactivity due to the presence of the carbonyl group. The acetyloxy group contributes to its potential as an electrophile in various chemical reactions, while the fluorine atom in the 3-position of the phenyl ring can influence its electronic properties, enhancing lipophilicity and potentially affecting its biological activity. The compound may display moderate solubility in organic solvents and limited solubility in water, typical of many aromatic compounds. Its unique structure suggests potential applications in pharmaceuticals or materials science, where the specific functional groups can be leveraged for targeted interactions or modifications. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₅H₁₁FO₃

InChI: InChI=1S/C15H11FO3/c1-10(17)19-14-8-3-2-7-13(14)15(18)11-5-4-6-12(16)9-11/h2-9H,1H3

InChI key: InChIKey=PXZBLVCKLCCZRV-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(OC(C)=O)C=CC=C1)C2=CC(F)=CC=C2

Synonyms:

• [2-(Acetyloxy)phenyl](3-fluorophenyl)methanone
• 2-(3-Fluorobenzoyl)phenyl acetate
• Methanone, [2-(acetyloxy)phenyl](3-fluorophenyl)-

2-Acetoxy-3'-fluorobenzophenone

CAS: 890099-01-1

Formula: C₁₅H₁₁FO₃

Molecular weight: 258.2444

Ref: IN-DA00444K