CymitQuimica logo

CAS 890099-02-2

:

Methanone, [3-(acetyloxy)phenyl](3,5-dimethoxyphenyl)-

Description:
Methanone, [3-(acetyloxy)phenyl](3,5-dimethoxyphenyl)-, also known by its CAS number 890099-02-2, is an organic compound characterized by its complex structure that includes a methanone functional group and multiple aromatic rings. This compound features a phenyl group substituted with an acetyloxy group at the 3-position, which enhances its reactivity and solubility in organic solvents. Additionally, it contains a 3,5-dimethoxyphenyl moiety, contributing to its potential applications in medicinal chemistry and organic synthesis. The presence of methoxy groups typically increases the electron density on the aromatic rings, influencing the compound's reactivity and interaction with biological targets. Methanone derivatives often exhibit interesting pharmacological properties, making them subjects of research in drug development. The compound's physical properties, such as melting point, boiling point, and solubility, would depend on its specific molecular interactions and the presence of functional groups. Overall, this compound represents a class of methanones that may have significant implications in various chemical and pharmaceutical applications.
Formula:C17H16O5
InChI:InChI=1/C17H16O5/c1-11(18)22-14-6-4-5-12(7-14)17(19)13-8-15(20-2)10-16(9-13)21-3/h4-10H,1-3H3
InChI key:InChIKey=VNTLWAJBEHFPCE-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(OC)=CC(OC)=C1)C2=CC(OC(C)=O)=CC=C2
Synonyms:
  • Methanone, [3-(acetyloxy)phenyl](3,5-dimethoxyphenyl)-
  • 3-(3,5-Dimethoxybenzoyl)phenyl acetate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.