CAS 890099-04-4
:[2-(Acetyloxy)phenyl](4-fluorophenyl)methanone
Description:
[2-(Acetyloxy)phenyl](4-fluorophenyl)methanone, with the CAS number 890099-04-4, is an organic compound characterized by its complex structure, which includes an acetyloxy group and a fluorophenyl moiety. This compound typically exhibits properties common to aromatic ketones, such as a relatively high melting point and solubility in organic solvents like ethanol and dichloromethane. The presence of the acetyloxy group suggests potential reactivity in nucleophilic substitution reactions, while the fluorine atom in the para position can influence the compound's electronic properties, potentially enhancing its reactivity and lipophilicity. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can affect its stability and reactivity in different environments. Overall, this compound's unique functional groups and structural features contribute to its potential applications in organic synthesis and medicinal chemistry.
Formula:C15H11FO3
InChI:InChI=1/C15H11FO3/c1-10(17)19-14-5-3-2-4-13(14)15(18)11-6-8-12(16)9-7-11/h2-9H,1H3
InChI key:InChIKey=LXLFOWZGDDSSMN-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(OC(C)=O)C=CC=C1)C2=CC=C(F)C=C2
Synonyms:- [2-(Acetyloxy)phenyl](4-fluorophenyl)methanone
- 2-(4-Fluorobenzoyl)phenyl acetate
- Methanone, [2-(acetyloxy)phenyl](4-fluorophenyl)-
- 2-Acetoxy-4′-fluorobenzophenone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.