CAS 890099-05-5
:Methanone, [3-(acetyloxy)phenyl](2,3-dimethylphenyl)-
Description:
Methanone, [3-(acetyloxy)phenyl](2,3-dimethylphenyl)-, also known by its CAS number 890099-05-5, is an organic compound characterized by its complex structure that includes a methanone functional group and aromatic rings. This compound features a phenyl group substituted at the 3-position with an acetyloxy group, which enhances its reactivity and solubility in organic solvents. The presence of the 2,3-dimethylphenyl moiety contributes to its hydrophobic characteristics and may influence its biological activity. Methanone derivatives often exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The compound's molecular structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals. Its synthesis typically involves acylation reactions, and it may be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its identity and purity. As with many organic compounds, safety precautions should be observed when handling this substance due to potential toxicity and reactivity.
Formula:C17H16O3
InChI:InChI=1S/C17H16O3/c1-11-6-4-9-16(12(11)2)17(19)14-7-5-8-15(10-14)20-13(3)18/h4-10H,1-3H3
InChI key:InChIKey=OIUCVWIJISSBFS-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(OC(C)=O)=CC=C1)C2=C(C)C(C)=CC=C2
Synonyms:- Methanone, [3-(acetyloxy)phenyl](2,3-dimethylphenyl)-
- 3-Acetoxy-2′,3′-dimethylbenzophenone
- 3-(2,3-Dimethylbenzoyl)phenyl acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
