CAS 890099-06-6

Methanone, [2-(acetyloxy)phenyl](2,5-dimethylphenyl)-

Description:

Methanone, [2-(acetyloxy)phenyl](2,5-dimethylphenyl)-, also known by its CAS number 890099-06-6, is an organic compound characterized by its ketone functional group and the presence of an acetyloxy group attached to a phenyl ring. This compound features a complex structure that includes a methanone moiety linked to a substituted phenyl group, specifically a 2-(acetyloxy)phenyl and a 2,5-dimethylphenyl group. The presence of the acetyloxy group suggests that it may exhibit reactivity typical of esters, potentially participating in hydrolysis or transesterification reactions. The dimethyl substitution on the phenyl ring can influence the compound's electronic properties and steric hindrance, affecting its reactivity and interactions with other molecules. Methanone derivatives often find applications in organic synthesis, pharmaceuticals, and materials science due to their diverse chemical properties. However, specific applications and reactivity would depend on the overall molecular context and the presence of other functional groups.

Formula: C₁₇H₁₆O₃

InChI: InChI=1S/C17H16O3/c1-11-8-9-12(2)15(10-11)17(19)14-6-4-5-7-16(14)20-13(3)18/h4-10H,1-3H3

InChI key: InChIKey=JVERENSHMHMPCV-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(OC(C)=O)C=CC=C1)C2=C(C)C=CC(C)=C2

Synonyms:

• Methanone, [2-(acetyloxy)phenyl](2,5-dimethylphenyl)-
• 2-(2,5-Dimethylbenzoyl)phenyl acetate

2-Acetoxy-2′,5′-methylbenzophenone

CAS: 890099-06-6

Formula: C₁₇H₁₆O₃

Purity: 90.0%

Molecular weight: 268.312

Ref: 10-F201757