CAS 890099-11-3
:Methanone, [3-(acetyloxy)phenyl](2,5-dimethylphenyl)-
Description:
Methanone, [3-(acetyloxy)phenyl](2,5-dimethylphenyl)-, also known by its CAS number 890099-11-3, is an organic compound characterized by its ketone functional group and the presence of multiple aromatic rings. This compound features a methanone moiety, which is indicative of a carbonyl group (C=O) bonded to a phenyl group that is further substituted with an acetyloxy group at the para position. The presence of the acetyloxy group suggests that it can participate in various chemical reactions, such as esterification or hydrolysis. The two methyl groups on the second phenyl ring contribute to its hydrophobic character and influence its physical properties, such as melting and boiling points. Additionally, the compound's structure may exhibit potential for biological activity, making it of interest in medicinal chemistry. Its synthesis and reactivity can be explored in the context of organic synthesis and material science, particularly in the development of pharmaceuticals or agrochemicals.
Formula:C17H16O3
InChI:InChI=1S/C17H16O3/c1-11-7-8-12(2)16(9-11)17(19)14-5-4-6-15(10-14)20-13(3)18/h4-10H,1-3H3
InChI key:InChIKey=YQCNSUPKPLGESS-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(C)C=CC(C)=C1)C2=CC(OC(C)=O)=CC=C2
Synonyms:- Methanone, [3-(acetyloxy)phenyl](2,5-dimethylphenyl)-
- 3-Acetoxy-2′,5′-dimethylbenzophenone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
