CAS 890099-12-4

[2-(3,4-dimethylbenzoyl)phenyl] acetate

Description:

[2-(3,4-dimethylbenzoyl)phenyl] acetate is an organic compound characterized by its structure, which includes a phenyl group substituted with an acetate moiety and a 3,4-dimethylbenzoyl group. This compound typically exhibits properties common to aromatic esters, such as moderate volatility and solubility in organic solvents. It may possess a distinct aromatic odor due to the presence of the benzoyl groups. The presence of methyl groups on the benzoyl moiety can influence its reactivity and stability, potentially enhancing its lipophilicity. In terms of applications, compounds like this are often explored in fields such as organic synthesis, pharmaceuticals, and materials science, particularly for their potential roles as intermediates or in the development of functional materials. Safety data sheets would typically indicate handling precautions due to potential irritant properties. As with many organic compounds, proper storage and handling are essential to ensure stability and minimize exposure risks.

Formula: C₁₇H₁₆O₃

InChI: InChI=1/C17H16O3/c1-11-8-9-14(10-12(11)2)17(19)15-6-4-5-7-16(15)20-13(3)18/h4-10H,1-3H3

SMILES: Cc1ccc(cc1C)C(=O)c1ccccc1OC(=O)C

2-Acetoxy-3′,4′-methylbenzophenone

CAS: 890099-12-4

Formula: C₁₇H₁₆O₃

Purity: 90.0%

Molecular weight: 268.312

Ref: 10-F201759