CAS 890099-13-5

[2-(Acetyloxy)phenyl](4-chlorophenyl)methanone

Description:

[2-(Acetyloxy)phenyl](4-chlorophenyl)methanone, with the CAS number 890099-13-5, is an organic compound characterized by its complex structure, which includes an acetyloxy group and a chlorophenyl moiety. This compound typically exhibits properties associated with aromatic ketones, such as stability and moderate reactivity due to the presence of the carbonyl group. The acetyloxy group contributes to its potential as a reactive intermediate in various chemical reactions, including acylation and esterification. The presence of the chlorine atom in the para position of the phenyl ring can influence the compound's electronic properties, making it more electrophilic and potentially enhancing its reactivity in nucleophilic substitution reactions. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical applications. Its solubility characteristics would likely depend on the solvent polarity, with potential solubility in organic solvents due to its hydrophobic aromatic structure. Overall, this compound's unique functional groups and structural features make it a subject of interest in both synthetic organic chemistry and medicinal chemistry.

Formula: C₁₅H₁₁ClO₃

InChI: InChI=1S/C15H11ClO3/c1-10(17)19-14-5-3-2-4-13(14)15(18)11-6-8-12(16)9-7-11/h2-9H,1H3

InChI key: InChIKey=JPDVONYBLNNEPR-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(OC(C)=O)C=CC=C1)C2=CC=C(Cl)C=C2

Synonyms:

• Methanone, [2-(acetyloxy)phenyl](4-chlorophenyl)-
• 2-Acetoxy-4′-chlorobenzophenone
• [2-(Acetyloxy)phenyl](4-chlorophenyl)methanone

2-Acetoxy-4′-chlorobenzophenone

CAS: 890099-13-5

Formula: C₁₅H₁₁ClO₃

Purity: 90.0%

Molecular weight: 274.7

Ref: 10-F201709