CAS 890099-15-7

Methanone, [2-(acetyloxy)phenyl](3,5-dimethylphenyl)-

Description:

Methanone, [2-(acetyloxy)phenyl](3,5-dimethylphenyl)-, also known by its CAS number 890099-15-7, is an organic compound characterized by its ketone functional group and the presence of an acetyloxy group attached to a phenyl ring. This compound features a complex structure that includes a phenyl moiety substituted with both acetyloxy and dimethyl groups, contributing to its unique chemical properties. The acetyloxy group enhances its reactivity, making it a potential candidate for various chemical reactions, including esterification and acylation. The presence of multiple methyl groups can influence the compound's steric hindrance and electronic properties, potentially affecting its solubility and reactivity in different solvents. Methanone derivatives are often studied for their applications in pharmaceuticals, agrochemicals, and materials science due to their diverse biological activities and functional properties. Understanding the characteristics of such compounds is crucial for their application in synthetic chemistry and industrial processes.

Formula: C₁₇H₁₆O₃

InChI: InChI=1S/C17H16O3/c1-11-8-12(2)10-14(9-11)17(19)15-6-4-5-7-16(15)20-13(3)18/h4-10H,1-3H3

InChI key: InChIKey=UVAUFBIYKFNXEY-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(OC(C)=O)C=CC=C1)C2=CC(C)=CC(C)=C2

Synonyms:

• Methanone, [2-(acetyloxy)phenyl](3,5-dimethylphenyl)-
• 2-(3,5-Dimethylbenzoyl)phenyl acetate

2-Acetoxy-3′,5′-methylbenzophenone

CAS: 890099-15-7

Formula: C₁₇H₁₆O₃

Purity: 90.0%

Molecular weight: 268.312

Ref: 10-F201760