CAS 890099-16-8

[2-(2-bromobenzoyl)phenyl] acetate

Description:

[2-(2-bromobenzoyl)phenyl] acetate, with the CAS number 890099-16-8, is an organic compound characterized by its complex structure that includes both an acetate group and a bromobenzoyl moiety. This compound typically appears as a solid or crystalline substance, exhibiting moderate solubility in organic solvents such as ethanol and dichloromethane, while being less soluble in water due to its hydrophobic characteristics. The presence of the bromine atom in the benzoyl group can impart unique reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound may exhibit interesting biological activities, which could be explored in pharmaceutical applications. Its molecular structure suggests potential for interactions with biological targets, making it of interest in medicinal chemistry. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with brominated compounds.

Formula: C₁₅H₁₁BrO₃

InChI: InChI=1/C15H11BrO3/c1-10(17)19-14-9-5-3-7-12(14)15(18)11-6-2-4-8-13(11)16/h2-9H,1H3

SMILES: CC(=O)Oc1ccccc1C(=O)c1ccccc1Br

2-Acetoxy-2′-bromobenzophenone

CAS: 890099-16-8

Formula: C₁₅H₁₁BrO₃

Purity: 90.0%

Molecular weight: 319.154

Ref: 10-F201710