CAS 890099-18-0

[2-(3,4,5-trifluorobenzoyl)phenyl] acetate

Description:

[2-(3,4,5-trifluorobenzoyl)phenyl] acetate, with the CAS number 890099-18-0, is an organic compound characterized by its complex aromatic structure. It features a phenyl ring substituted with a trifluorobenzoyl group and an acetate moiety, contributing to its unique chemical properties. The presence of trifluoromethyl groups enhances its lipophilicity and may influence its reactivity and interactions with biological systems. This compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity can be influenced by the electron-withdrawing nature of the trifluorobenzoyl group. It may participate in various chemical reactions typical of esters and aromatic compounds, such as nucleophilic substitutions or hydrolysis. Additionally, due to the presence of fluorine atoms, it may exhibit distinctive physical properties, such as altered boiling and melting points compared to non-fluorinated analogs. Its applications could span fields such as pharmaceuticals, agrochemicals, or materials science, depending on its specific reactivity and interactions.

Formula: C₁₅H₉F₃O₃

InChI: InChI=1/C15H9F3O3/c1-8(19)21-13-5-3-2-4-10(13)15(20)9-6-11(16)14(18)12(17)7-9/h2-7H,1H3

SMILES: CC(=O)Oc1ccccc1C(=O)c1cc(c(c(c1)F)F)F

2-Acetoxy-3′,4′,5′-trifluorobenzophenone

CAS: 890099-18-0

Formula: C₁₅H₉F₃O₃

Purity: 90.0%

Molecular weight: 294.229

Ref: 10-F201761