CAS 890099-21-5
:[2-(2,3,4,5,6-pentafluorobenzoyl)phenyl] acetate
Description:
[2-(2,3,4,5,6-pentafluorobenzoyl)phenyl] acetate, with the CAS number 890099-21-5, is an organic compound characterized by its complex structure that includes a phenyl ring substituted with a pentafluorobenzoyl group and an acetate moiety. This compound is notable for its high degree of fluorination, which imparts unique properties such as increased lipophilicity and thermal stability. The presence of multiple fluorine atoms enhances its chemical resistance and can influence its reactivity and interaction with biological systems. Typically, compounds like this may exhibit interesting optical properties and can be utilized in various applications, including materials science and pharmaceuticals. The acetate functional group suggests potential for esterification reactions, making it a versatile intermediate in organic synthesis. Additionally, the fluorinated aromatic system may contribute to specific electronic characteristics, making it of interest in the development of advanced materials or as a potential ligand in coordination chemistry. Overall, this compound exemplifies the intriguing chemistry associated with fluorinated organic molecules.
Formula:C15H7F5O3
InChI:InChI=1/C15H7F5O3/c1-6(21)23-8-5-3-2-4-7(8)15(22)9-10(16)12(18)14(20)13(19)11(9)17/h2-5H,1H3
SMILES:CC(=O)Oc1ccccc1C(=O)c1c(c(c(c(c1F)F)F)F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
