CAS 890099-22-6
:[2-(2-iodobenzoyl)phenyl] acetate
Description:
[2-(2-Iodobenzoyl)phenyl] acetate is an organic compound characterized by its structure, which includes an acetate group and a phenyl ring substituted with a 2-iodobenzoyl moiety. This compound typically appears as a solid or crystalline substance, and its molecular structure suggests it may exhibit specific reactivity due to the presence of the iodine atom, which can participate in nucleophilic substitution reactions. The iodobenzoyl group can enhance the compound's lipophilicity, potentially influencing its solubility in organic solvents. Additionally, the presence of the acetate group may impart certain polar characteristics, affecting its interaction with other chemical species. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in synthesis and as a precursor for more complex molecules. As with many organic compounds, safety precautions should be observed when handling it, considering the potential hazards associated with iodine-containing compounds.
Formula:C15H11IO3
InChI:InChI=1/C15H11IO3/c1-10(17)19-14-9-5-3-7-12(14)15(18)11-6-2-4-8-13(11)16/h2-9H,1H3
SMILES:CC(=O)Oc1ccccc1C(=O)c1ccccc1I
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.