CAS 890099-23-7
:[3-(3,4,5-trifluorobenzoyl)phenyl] acetate
Description:
[3-(3,4,5-trifluorobenzoyl)phenyl] acetate is an organic compound characterized by its complex structure, which includes a phenyl ring substituted with a trifluorobenzoyl group and an acetate moiety. This compound is likely to exhibit properties typical of aromatic esters, including moderate solubility in organic solvents and potential reactivity due to the presence of the trifluorobenzoyl group, which can influence its electronic properties and stability. The trifluoromethyl groups are known to enhance lipophilicity and can affect the compound's biological activity, making it of interest in pharmaceutical applications. Additionally, the presence of fluorine atoms often imparts unique characteristics such as increased metabolic stability and altered interaction with biological targets. The compound may also exhibit specific melting and boiling points, as well as distinct spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Overall, [3-(3,4,5-trifluorobenzoyl)phenyl] acetate represents a versatile chemical entity with potential applications in various fields, including medicinal chemistry and materials science.
Formula:C15H9F3O3
InChI:InChI=1/C15H9F3O3/c1-8(19)21-11-4-2-3-9(5-11)15(20)10-6-12(16)14(18)13(17)7-10/h2-7H,1H3
SMILES:CC(=O)Oc1cccc(c1)C(=O)c1cc(c(c(c1)F)F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
