CAS 890099-24-8
:Methanone, [3-(acetyloxy)phenyl](2-methoxyphenyl)-
Description:
Methanone, [3-(acetyloxy)phenyl](2-methoxyphenyl)-, also known by its CAS number 890099-24-8, is an organic compound characterized by its complex structure that includes both methanone and aromatic functionalities. This compound features a phenyl ring substituted with an acetyloxy group at the 3-position and a methoxy group at the 2-position of another phenyl ring. The presence of these functional groups suggests that it may exhibit properties typical of esters and aromatic compounds, such as potential reactivity in electrophilic aromatic substitution reactions. Its molecular structure indicates that it may have applications in organic synthesis or as an intermediate in the production of pharmaceuticals or agrochemicals. Additionally, the presence of methoxy and acetyloxy groups may influence its solubility, stability, and biological activity. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C16H14O4
InChI:InChI=1S/C16H14O4/c1-11(17)20-13-7-5-6-12(10-13)16(18)14-8-3-4-9-15(14)19-2/h3-10H,1-2H3
InChI key:InChIKey=NEGDQYPBNCJOOL-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(OC)C=CC=C1)C2=CC(OC(C)=O)=CC=C2
Synonyms:- 3-(2-Methoxybenzoyl)phenyl acetate
- Methanone, [3-(acetyloxy)phenyl](2-methoxyphenyl)-
- 3-Acetoxy-2′-methoxybenzophenone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
