CAS 890099-28-2
:[2-(4-iodobenzoyl)phenyl] acetate
Description:
[2-(4-Iodobenzoyl)phenyl] acetate is an organic compound characterized by its complex aromatic structure, which includes a phenyl ring substituted with an iodobenzoyl group and an acetate functional group. The presence of the iodine atom enhances its reactivity and can influence its physical properties, such as solubility and boiling point. This compound typically appears as a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its molecular structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to the presence of both the aromatic system and the acetate moiety, which can participate in various chemical reactions. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, allowing for its identification and characterization in laboratory settings. Safety data should be consulted, as the presence of iodine can pose health risks, necessitating appropriate handling and storage precautions.
Formula:C15H11IO3
InChI:InChI=1/C15H11IO3/c1-10(17)19-14-5-3-2-4-13(14)15(18)11-6-8-12(16)9-7-11/h2-9H,1H3
SMILES:CC(=O)Oc1ccccc1C(=O)c1ccc(cc1)I
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.