CAS 890099-29-3

Methanone, [4-(acetyloxy)phenyl](3-methoxyphenyl)-

Description:

Methanone, [4-(acetyloxy)phenyl](3-methoxyphenyl)-, also known by its CAS number 890099-29-3, is an organic compound characterized by its complex structure that includes a methanone functional group and aromatic rings. This compound features a phenyl group substituted with an acetyloxy group at one position and a methoxy group at another, contributing to its potential reactivity and solubility properties. The presence of these functional groups suggests that it may exhibit interesting chemical behavior, including potential for hydrogen bonding and interactions with other molecules. Methanone derivatives often play significant roles in various chemical reactions, including those in medicinal chemistry and materials science. Its specific applications may vary, but compounds with similar structures are frequently investigated for their biological activities, such as anti-inflammatory or anticancer properties. As with many organic compounds, the physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the environment in which the compound is studied.

Formula: C₁₆H₁₄O₄

InChI: InChI=1S/C16H14O4/c1-11(17)20-14-8-6-12(7-9-14)16(18)13-4-3-5-15(10-13)19-2/h3-10H,1-2H3

InChI key: InChIKey=CDKTZYSZRWGUGX-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(OC(C)=O)C=C1)C2=CC(OC)=CC=C2

Synonyms:

• Methanone, [4-(acetyloxy)phenyl](3-methoxyphenyl)-
• 4-(3-Methoxybenzoyl)phenyl acetate
• 4-Acetoxy-3′-methoxybenzophenone

4-Acetoxy-3'-methoxybenzophenone

CAS: 890099-29-3

Formula: C₁₆H₁₄O₄

Molecular weight: 270.28

Ref: IN-DA0043LD

4-Acetoxy-3′-methoxybenzophenone

CAS: 890099-29-3

Formula: C₁₆H₁₄O₄

Purity: 90.0%

Molecular weight: 270.284

Ref: 10-F201834