CAS 890099-30-6
:Methanone, [3-(acetyloxy)phenyl](2-methylphenyl)-
Description:
Methanone, [3-(acetyloxy)phenyl](2-methylphenyl)-, also known by its CAS number 890099-30-6, is an organic compound characterized by its ketone functional group and aromatic structure. This compound features a methanone moiety attached to a phenyl ring that has an acetyloxy substituent at the 3-position and a 2-methylphenyl group. The presence of the acetyloxy group indicates that it can undergo hydrolysis to release acetic acid, which may influence its reactivity and stability. The aromatic rings contribute to the compound's potential for π-π stacking interactions, which can affect its solubility and interactions in biological systems. Methanone derivatives often exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The compound's specific physical and chemical properties, such as melting point, boiling point, and solubility, would typically depend on its molecular structure and the presence of functional groups. Overall, this compound represents a class of organic molecules that may have applications in various fields, including pharmaceuticals and materials science.
Formula:C16H14O3
InChI:InChI=1/C16H14O3/c1-11-6-3-4-9-15(11)16(18)13-7-5-8-14(10-13)19-12(2)17/h3-10H,1-2H3
InChI key:InChIKey=OOEFYDRUTNPRAN-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(OC(C)=O)=CC=C1)C2=C(C)C=CC=C2
Synonyms:- 3-Acetoxy-2′-methylbenzophenone
- 3-(2-Methylbenzoyl)phenyl acetate
- Methanone, [3-(acetyloxy)phenyl](2-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.