CAS 890099-32-8
:[4-[2-(trifluoromethyl)benzoyl]phenyl] acetate
Description:
[4-[2-(Trifluoromethyl)benzoyl]phenyl] acetate, with the CAS number 890099-32-8, is an organic compound characterized by its complex aromatic structure. It features a phenyl acetate moiety linked to a benzoyl group that contains a trifluoromethyl substituent, which significantly influences its chemical properties. The presence of the trifluoromethyl group enhances the compound's lipophilicity and can affect its reactivity and interaction with biological systems. This compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity can be influenced by the presence of functional groups. It may also show interesting properties in terms of solubility in organic solvents due to its aromatic nature. Additionally, the trifluoromethyl group can impart unique electronic characteristics, making it a candidate for various applications in pharmaceuticals, agrochemicals, or materials science. As with many organic compounds, safety and handling precautions should be observed, particularly due to the potential toxicity associated with fluorinated compounds.
Formula:C16H11F3O3
InChI:InChI=1/C16H11F3O3/c1-10(20)22-12-8-6-11(7-9-12)15(21)13-4-2-3-5-14(13)16(17,18)19/h2-9H,1H3
SMILES:CC(=O)Oc1ccc(cc1)C(=O)c1ccccc1C(F)(F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
