CAS 890099-36-2

Methanone, [3-(acetyloxy)phenyl](4-methylphenyl)-

Description:

Methanone, [3-(acetyloxy)phenyl](4-methylphenyl)-, also known by its CAS number 890099-36-2, is an organic compound characterized by its ketone functional group and aromatic structure. This compound features a methanone moiety attached to a phenyl group that is further substituted with an acetyloxy group at the 3-position and a methyl group at the 4-position. The presence of the acetyloxy group suggests that it may exhibit reactivity typical of esters, while the aromatic rings contribute to its stability and potential for π-π interactions. The compound's structure indicates it may have applications in organic synthesis or as an intermediate in the production of more complex molecules. Additionally, the presence of multiple functional groups may influence its solubility, reactivity, and potential biological activity. Overall, this compound exemplifies the diversity of organic molecules and their potential utility in various chemical applications.

Formula: C₁₆H₁₄O₃

InChI: InChI=1S/C16H14O3/c1-11-6-8-13(9-7-11)16(18)14-4-3-5-15(10-14)19-12(2)17/h3-10H,1-2H3

InChI key: InChIKey=DNLDKWXXUUDBCO-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(OC(C)=O)=CC=C1)C2=CC=C(C)C=C2

Synonyms:

• 3-Acetoxy-4′-methylbenzophenone
• 3-(4-Methylbenzoyl)phenyl acetate
• Methanone, [3-(acetyloxy)phenyl](4-methylphenyl)-