CAS 890099-38-4

Methanone, [4-(acetyloxy)phenyl][4-(trifluoromethyl)phenyl]-

Description:

Methanone, [4-(acetyloxy)phenyl][4-(trifluoromethyl)phenyl]- is an organic compound characterized by its complex structure, which includes both an acetyloxy group and a trifluoromethyl group attached to phenyl rings. This compound is part of the ketone family, where the carbonyl group (C=O) is bonded to two aromatic rings. The presence of the acetyloxy group suggests that it may exhibit reactivity typical of esters, while the trifluoromethyl group can significantly influence the compound's electronic properties, making it more lipophilic and potentially enhancing its biological activity. The trifluoromethyl group is known for imparting unique characteristics, such as increased stability and altered solubility. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its potential applications in drug development and as a building block in organic synthesis. Its specific properties, such as melting point, boiling point, and solubility, would require further investigation through experimental data or literature.

Formula: C₁₆H₁₁F₃O₃

InChI: InChI=1S/C16H11F3O3/c1-10(20)22-14-8-4-12(5-9-14)15(21)11-2-6-13(7-3-11)16(17,18)19/h2-9H,1H3

InChI key: InChIKey=WKVDAWDCDYQGOR-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(C(F)(F)F)C=C1)C2=CC=C(OC(C)=O)C=C2

Synonyms:

• 4-Acetoxy-4′-trifluoromethylbenzophenone
• 4-[4-(Trifluoromethyl)benzoyl]phenyl acetate
• Methanone, [4-(acetyloxy)phenyl][4-(trifluoromethyl)phenyl]-

4-Acetoxy-4'-trifluoromethylbenzophenone

CAS: 890099-38-4

Formula: C₁₆H₁₁F₃O₃

Molecular weight: 308.2519

Ref: IN-DA00444E