CAS 890099-40-8

Methanone, [4-(acetyloxy)phenyl](2-fluorophenyl)-

Description:

Methanone, [4-(acetyloxy)phenyl](2-fluorophenyl)-, also known by its CAS number 890099-40-8, is an organic compound characterized by its ketone functional group and the presence of both acetyloxy and fluorophenyl substituents. This compound features a phenyl ring substituted at the para position with an acetyloxy group, which enhances its reactivity and solubility in organic solvents. The presence of a fluorine atom on the adjacent phenyl ring can influence the compound's electronic properties, potentially affecting its reactivity and interaction with biological systems. Methanone derivatives often exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The compound's structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Additionally, its synthesis typically involves standard organic reactions, such as acylation and substitution, making it accessible for further research and development. Overall, this compound exemplifies the diverse chemistry of substituted ketones and their potential utility in various chemical and pharmaceutical applications.

Formula: C₁₅H₁₁FO₃

InChI: InChI=1S/C15H11FO3/c1-10(17)19-12-8-6-11(7-9-12)15(18)13-4-2-3-5-14(13)16/h2-9H,1H3

InChI key: InChIKey=SZGJOQCYNCAYFY-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(F)C=CC=C1)C2=CC=C(OC(C)=O)C=C2

Synonyms:

• 4-Acetoxy-2′-fluorobenzophenone
• 4-(2-Fluorobenzoyl)phenyl acetate
• Methanone, [4-(acetyloxy)phenyl](2-fluorophenyl)-

4-Acetoxy-2'-fluorobenzophenone

CAS: 890099-40-8

Formula: C₁₅H₁₁FO₃

Molecular weight: 258.2444

Ref: IN-DA00444D

4-Acetoxy-2′-fluorobenzophenone

CAS: 890099-40-8

Formula: C₁₅H₁₁FO₃

Purity: 90.0%

Molecular weight: 258.248

Ref: 10-F201842