CAS 890099-42-0

Methanone, [4-(acetyloxy)phenyl](3-fluorophenyl)-

Description:

Methanone, [4-(acetyloxy)phenyl](3-fluorophenyl)-, also known by its CAS number 890099-42-0, is an organic compound characterized by its complex structure featuring a methanone functional group. This compound includes a phenyl ring substituted with an acetyloxy group at the para position and a fluorine atom at the meta position relative to the methanone group. The presence of the acetyloxy group suggests that it may exhibit ester-like properties, potentially influencing its reactivity and solubility in various solvents. The fluorine atom can enhance the compound's lipophilicity and may affect its biological activity, making it of interest in medicinal chemistry. Additionally, the compound's structure indicates potential for hydrogen bonding and other intermolecular interactions, which could play a role in its physical properties and reactivity. Overall, this compound's unique functional groups and substituents contribute to its potential applications in pharmaceuticals and materials science.

Formula: C₁₅H₁₁FO₃

InChI: InChI=1S/C15H11FO3/c1-10(17)19-14-7-5-11(6-8-14)15(18)12-3-2-4-13(16)9-12/h2-9H,1H3

InChI key: InChIKey=YXQMSAYPGURGGO-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(F)=CC=C1)C2=CC=C(OC(C)=O)C=C2

Synonyms:

• 4-Acetoxy-3′-fluorobenzophenone
• Methanone, [4-(acetyloxy)phenyl](3-fluorophenyl)-
• 4-(3-Fluorobenzoyl)phenyl acetate

4-Acetoxy-3'-fluorobenzophenone

CAS: 890099-42-0

Formula: C₁₅H₁₁FO₃

Molecular weight: 258.2444

Ref: IN-DA0044R1