CAS 890099-43-1

[3-(Acetyloxy)phenyl][4-(trifluoromethyl)phenyl]methanone

Description:

The chemical substance known as [3-(Acetyloxy)phenyl][4-(trifluoromethyl)phenyl]methanone, with the CAS number 890099-43-1, is an organic compound characterized by its complex structure, which includes both acetyloxy and trifluoromethyl functional groups. This compound typically exhibits a high degree of lipophilicity due to the presence of the trifluoromethyl group, which can enhance its biological activity and influence its solubility in organic solvents. The acetyloxy group contributes to its reactivity, making it a potential candidate for various chemical reactions, including esterification and acylation. Additionally, the phenyl rings in its structure can provide stability and influence its electronic properties, potentially affecting its interactions in biological systems. Such compounds may be of interest in medicinal chemistry for their potential pharmacological properties, including anti-inflammatory or anticancer activities. However, specific applications and biological effects would require further investigation through experimental studies.

Formula: C₁₆H₁₁F₃O₃

InChI: InChI=1S/C16H11F3O3/c1-10(20)22-14-4-2-3-12(9-14)15(21)11-5-7-13(8-6-11)16(17,18)19/h2-9H,1H3

InChI key: InChIKey=PKBDOSQEZSSTPE-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(OC(C)=O)=CC=C1)C2=CC=C(C(F)(F)F)C=C2

Synonyms:

• Methanone, [3-(acetyloxy)phenyl][4-(trifluoromethyl)phenyl]-
• [3-(Acetyloxy)phenyl][4-(trifluoromethyl)phenyl]methanone
• 3-[4-(Trifluoromethyl)benzoyl]phenyl acetate

3-Acetoxy-4′-trifluorobenzophenone

CAS: 890099-43-1

Formula: C₁₆H₁₁F₃O₃

Purity: 90.0%

Molecular weight: 308.256

Ref: 10-F201772