CAS 890099-44-2

Methanone, [4-(acetyloxy)phenyl](2-bromophenyl)-

Description:

Methanone, [4-(acetyloxy)phenyl](2-bromophenyl)-, also known by its CAS number 890099-44-2, is an organic compound characterized by its complex structure, which includes a methanone functional group and two aromatic rings. The presence of the acetyloxy group indicates that it has an ester functional group, contributing to its reactivity and potential applications in organic synthesis. The bromine atom attached to one of the phenyl rings enhances the compound's electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. This compound may exhibit properties typical of aromatic compounds, such as stability and distinct UV-Vis absorption characteristics. Its solubility can vary depending on the solvent, influenced by the hydrophobic nature of the aromatic rings and the polar acetyloxy group. Methanone derivatives are often studied for their potential biological activities, including anti-inflammatory and anticancer properties, making this compound of interest in medicinal chemistry. Overall, its unique structure and functional groups suggest a range of possible applications in both research and industry.

Formula: C₁₅H₁₁BrO₃

InChI: InChI=1S/C15H11BrO3/c1-10(17)19-12-8-6-11(7-9-12)15(18)13-4-2-3-5-14(13)16/h2-9H,1H3

InChI key: InChIKey=JJPADGRBOLMGKG-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(Br)C=CC=C1)C2=CC=C(OC(C)=O)C=C2

Synonyms:

• Methanone, [4-(acetyloxy)phenyl](2-bromophenyl)-
• 4-(2-Bromobenzoyl)phenyl acetate
• 4-Acetoxy-2′-bromobenzophenone

4-Acetoxy-2'-bromobenzophenone

CAS: 890099-44-2

Formula: C₁₅H₁₁BrO₃

Molecular weight: 319.15

Ref: IN-DA0044R0

4-Acetoxy-2′-bromobenzophenone

CAS: 890099-44-2

Formula: C₁₅H₁₁BrO₃

Purity: 90.0%

Molecular weight: 319.154

Ref: 10-F201848