CymitQuimica logo

CAS 890099-45-3

:

[3-(2-fluorobenzoyl)phenyl] acetate

Description:
[3-(2-Fluorobenzoyl)phenyl] acetate is an organic compound characterized by its aromatic structure, which includes a phenyl ring substituted with a 2-fluorobenzoyl group and an acetate moiety. This compound typically exhibits properties common to aromatic esters, such as moderate solubility in organic solvents and relatively low solubility in water due to its hydrophobic nature. The presence of the fluorine atom can influence its reactivity and polarity, potentially enhancing its biological activity or altering its interaction with other chemical species. The compound may also display specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Additionally, due to its structural features, it may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C15H11FO3
InChI:InChI=1/C15H11FO3/c1-10(17)19-12-6-4-5-11(9-12)15(18)13-7-2-3-8-14(13)16/h2-9H,1H3
SMILES:CC(=O)Oc1cccc(c1)C(=O)c1ccccc1F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.