CAS 890099-46-4

Methanone, [4-(acetyloxy)phenyl](3-bromophenyl)-

Description:

Methanone, [4-(acetyloxy)phenyl](3-bromophenyl)-, also known by its CAS number 890099-46-4, is an organic compound characterized by its complex structure that includes a methanone functional group, an acetyloxy group, and a bromophenyl moiety. This compound typically exhibits properties associated with aromatic compounds, such as stability and distinct reactivity patterns due to the presence of electron-withdrawing and electron-donating groups. The acetyloxy group enhances its solubility in organic solvents and may influence its reactivity in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions. The bromine atom in the structure can also impart unique electronic properties, potentially affecting the compound's reactivity and interaction with biological systems. Overall, this compound may be of interest in medicinal chemistry and materials science due to its potential applications in drug development and as a precursor in organic synthesis. However, specific physical properties such as melting point, boiling point, and solubility would need to be referenced from experimental data or literature for precise applications.

Formula: C₁₅H₁₁BrO₃

InChI: InChI=1/C15H11BrO3/c1-10(17)19-14-7-5-11(6-8-14)15(18)12-3-2-4-13(16)9-12/h2-9H,1H3

InChI key: InChIKey=RTEQVISIZXTINW-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Br)=CC=C1)C2=CC=C(OC(C)=O)C=C2

Synonyms:

• Methanone, [4-(acetyloxy)phenyl](3-bromophenyl)-
• 4-(3-Bromobenzoyl)phenyl acetate
• 4-Acetoxy-3′-bromobenzophenone

4-Acetoxy-3'-bromobenzophenone

CAS: 890099-46-4

Formula: C₁₅H₁₁BrO₃

Molecular weight: 319.15

Ref: IN-DA0043LB