CAS 890099-49-7
:[3-(Acetyloxy)phenyl](4-fluorophenyl)methanone
Description:
[3-(Acetyloxy)phenyl](4-fluorophenyl)methanone, with the CAS number 890099-49-7, is an organic compound characterized by its complex structure, which includes both acetyloxy and fluorophenyl functional groups. This compound typically exhibits properties associated with aromatic ketones, such as stability and reactivity due to the presence of the carbonyl group. The acetyloxy group contributes to its potential as an electrophile in various chemical reactions, while the fluorophenyl moiety can influence its electronic properties and lipophilicity, potentially enhancing its biological activity. The presence of the fluorine atom may also impart unique characteristics, such as increased metabolic stability or altered binding affinity in biological systems. In terms of solubility, compounds of this nature are often soluble in organic solvents but may have limited solubility in water. Overall, [3-(Acetyloxy)phenyl](4-fluorophenyl)methanone is of interest in medicinal chemistry and material science due to its potential applications in drug development and synthesis.
Formula:C15H11FO3
InChI:InChI=1S/C15H11FO3/c1-10(17)19-14-4-2-3-12(9-14)15(18)11-5-7-13(16)8-6-11/h2-9H,1H3
InChI key:InChIKey=NWIWPHISJUSWCP-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(OC(C)=O)=CC=C1)C2=CC=C(F)C=C2
Synonyms:- [3-(Acetyloxy)phenyl](4-fluorophenyl)methanone
- Methanone, [3-(acetyloxy)phenyl](4-fluorophenyl)-
- 3-Acetoxy-4′-fluorobenzophenone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.