CAS 890099-50-0

Methanone, [4-(acetyloxy)phenyl](3-iodophenyl)-

Description:

Methanone, [4-(acetyloxy)phenyl](3-iodophenyl)-, also known by its CAS number 890099-50-0, is an organic compound characterized by its complex structure, which includes a methanone functional group and aromatic rings. This compound features a phenyl group substituted with an iodine atom and another phenyl group that has an acetyloxy functional group. The presence of the iodine atom contributes to its potential reactivity and applications in various chemical reactions, including electrophilic substitutions. The acetyloxy group can enhance solubility and influence the compound's biological activity. Methanone derivatives often exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The compound's molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, which can affect its physical properties such as melting point, boiling point, and solubility in different solvents. Overall, this compound's unique characteristics make it a subject of interest for further research in organic synthesis and potential applications in pharmaceuticals.

Formula: C₁₅H₁₁IO₃

InChI: InChI=1S/C15H11IO3/c1-10(17)19-14-7-5-11(6-8-14)15(18)12-3-2-4-13(16)9-12/h2-9H,1H3

InChI key: InChIKey=BCDPBNWVSCACRY-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(I)=CC=C1)C2=CC=C(OC(C)=O)C=C2

Synonyms:

• Methanone, [4-(acetyloxy)phenyl](3-iodophenyl)-
• 4-(3-Iodobenzoyl)phenyl acetate
• 4-Acetoxy-3′-iodobenzophenone

4-Acetoxy-3'-iodobenzophenone

CAS: 890099-50-0

Formula: C₁₅H₁₁IO₃

Molecular weight: 366.1505

Ref: IN-DA00444B