CymitQuimica logo

CAS 890099-53-3

:

[3-(3-chlorobenzoyl)phenyl] acetate

Description:
[3-(3-Chlorobenzoyl)phenyl] acetate, with the CAS number 890099-53-3, is an organic compound characterized by its aromatic structure and the presence of both an acetate and a chlorobenzoyl functional group. This compound typically exhibits a solid state at room temperature and is likely to be soluble in organic solvents due to its hydrophobic aromatic components. The chlorobenzoyl group introduces a chlorine atom, which can influence the compound's reactivity and polarity, potentially enhancing its biological activity or interaction with other molecules. The acetate moiety contributes to the compound's ester characteristics, which may affect its stability and reactivity in various chemical environments. As with many organic compounds, it is essential to handle [3-(3-chlorobenzoyl)phenyl] acetate with care, considering potential toxicity and environmental impact. Its specific applications may vary, but compounds of this nature are often explored in fields such as pharmaceuticals, agrochemicals, or materials science for their unique properties and potential utility in synthesis or as intermediates.
Formula:C15H11ClO3
InChI:InChI=1/C15H11ClO3/c1-10(17)19-14-7-3-5-12(9-14)15(18)11-4-2-6-13(16)8-11/h2-9H,1H3
SMILES:CC(=O)Oc1cccc(c1)C(=O)c1cccc(c1)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.