CymitQuimica logo

CAS 890099-54-4

:

3-[4-(Acetyloxy)benzoyl]benzonitrile

Description:
3-[4-(Acetyloxy)benzoyl]benzonitrile, identified by its CAS number 890099-54-4, is an organic compound characterized by its complex structure, which includes a benzene ring substituted with both an acetyloxy group and a benzonitrile moiety. This compound typically exhibits properties associated with aromatic compounds, such as stability and relatively high melting and boiling points compared to aliphatic compounds. The presence of the acetyloxy group suggests potential reactivity in esterification or hydrolysis reactions, while the benzonitrile group indicates the presence of a nitrile functional group, which can participate in nucleophilic addition reactions. Additionally, this compound may display interesting optical properties due to its conjugated system, making it potentially useful in applications such as organic electronics or as a dye. Its solubility is likely influenced by the polar acetyloxy group, which can enhance solubility in polar solvents. Overall, 3-[4-(Acetyloxy)benzoyl]benzonitrile is a versatile compound with potential applications in various fields of chemistry and materials science.
Formula:C16H11NO3
InChI:InChI=1S/C16H11NO3/c1-11(18)20-15-7-5-13(6-8-15)16(19)14-4-2-3-12(9-14)10-17/h2-9H,1H3
InChI key:InChIKey=PPTJMDPDFOYEOR-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(OC(C)=O)C=C1)C2=CC(C#N)=CC=C2
Synonyms:
  • Benzonitrile, 3-[4-(acetyloxy)benzoyl]-
  • 3-[4-(Acetyloxy)benzoyl]benzonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.