CAS 890099-55-5

[3-(4-chlorobenzoyl)phenyl] acetate

Description:

[3-(4-chlorobenzoyl)phenyl] acetate, with the CAS number 890099-55-5, is an organic compound characterized by its structure, which features an acetate group attached to a phenyl ring that is further substituted with a 4-chlorobenzoyl moiety. This compound typically exhibits properties common to aromatic esters, including moderate solubility in organic solvents and limited solubility in water due to its hydrophobic nature. The presence of the chlorobenzoyl group can influence its reactivity and stability, potentially enhancing its biological activity or interaction with other chemical species. It may be used in various applications, including pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. The compound's physical properties, such as melting point, boiling point, and spectral characteristics (like NMR and IR), would provide further insights into its behavior and potential uses. Safety data should be consulted to understand any hazards associated with handling this substance.

Formula: C₁₅H₁₁ClO₃

InChI: InChI=1/C15H11ClO3/c1-10(17)19-14-4-2-3-12(9-14)15(18)11-5-7-13(16)8-6-11/h2-9H,1H3

SMILES: CC(=O)Oc1cccc(c1)C(=O)c1ccc(cc1)Cl

3-Acetoxy-4′-chlorobenzophenone

CAS: 890099-55-5

Formula: C₁₅H₁₁ClO₃

Purity: 90.0%

Molecular weight: 274.7

Ref: 10-F201778