CAS 890099-56-6
:[4-(4-cyanobenzoyl)phenyl] acetate
Description:
[4-(4-Cyanobenzoyl)phenyl] acetate, with the CAS number 890099-56-6, is an organic compound characterized by its aromatic structure and functional groups. It features a phenyl ring substituted with both a cyanobenzoyl group and an acetate moiety. The presence of the cyanobenzoyl group introduces a strong electron-withdrawing cyano group, which can influence the compound's reactivity and stability. This compound is likely to exhibit properties typical of aromatic esters, including moderate solubility in organic solvents and potential applications in materials science, particularly in the development of photoresponsive or thermally stable materials. Its structure suggests potential for use in organic synthesis and as an intermediate in the production of more complex molecules. Additionally, the presence of the cyano group may impart unique optical properties, making it of interest in fields such as photonics or dye chemistry. As with many organic compounds, handling should be done with care, considering potential toxicity and environmental impact.
Formula:C16H11NO3
InChI:InChI=1/C16H11NO3/c1-11(18)20-15-8-6-14(7-9-15)16(19)13-4-2-12(10-17)3-5-13/h2-9H,1H3
SMILES:CC(=O)Oc1ccc(cc1)C(=O)c1ccc(cc1)C#N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
