CAS 890099-57-7

Methanone, [3-(acetyloxy)phenyl](2-bromophenyl)-

Description:

Methanone, [3-(acetyloxy)phenyl](2-bromophenyl)-, also known by its CAS number 890099-57-7, is an organic compound characterized by its complex structure that includes a methanone functional group, a phenyl ring substituted with an acetyloxy group, and another phenyl ring that is brominated. This compound typically exhibits properties associated with aromatic compounds, such as stability and distinct reactivity patterns due to the presence of electron-withdrawing and electron-donating groups. The acetyloxy group can enhance the compound's solubility in organic solvents and may influence its reactivity in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions. The bromine atom introduces additional reactivity, allowing for potential halogenation reactions. Overall, this compound may be of interest in synthetic organic chemistry and medicinal chemistry due to its structural features, which could lead to various applications in drug development or material science. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₁₅H₁₁BrO₃

InChI: InChI=1S/C15H11BrO3/c1-10(17)19-12-6-4-5-11(9-12)15(18)13-7-2-3-8-14(13)16/h2-9H,1H3

InChI key: InChIKey=WEJIBCDQSQAPQC-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(OC(C)=O)=CC=C1)C2=C(Br)C=CC=C2

Synonyms:

• 3-Acetoxy-2′-bromobenzophenone
• 3-(2-Bromobenzoyl)phenyl acetate
• Methanone, [3-(acetyloxy)phenyl](2-bromophenyl)-

3-Acetoxy-2'-bromobenzophenone

CAS: 890099-57-7

Formula: C₁₅H₁₁BrO₃

Molecular weight: 319.15

Ref: IN-DA004449

3-Acetoxy-2′-bromobenzophenone

CAS: 890099-57-7

Formula: C₁₅H₁₁BrO₃

Purity: 90.0%

Molecular weight: 319.154

Ref: 10-F201779