CAS 890099-59-9

[3-(3-bromobenzoyl)phenyl] acetate

Description:

[3-(3-bromobenzoyl)phenyl] acetate is an organic compound characterized by its complex structure, which includes a phenyl ring substituted with a bromobenzoyl group and an acetate moiety. This compound typically exhibits a white to off-white crystalline appearance. It is likely to be soluble in organic solvents such as ethanol and dichloromethane, while being less soluble in water due to its hydrophobic characteristics. The presence of the bromine atom introduces notable electronegative properties, which can influence the compound's reactivity and potential applications in organic synthesis or medicinal chemistry. The acetate group may also impart certain functional properties, such as acting as a leaving group in chemical reactions. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. As with many organic compounds, handling should be done with care, considering potential toxicity and environmental impact. Proper safety protocols should be followed when working with this substance in a laboratory setting.

Formula: C₁₅H₁₁BrO₃

InChI: InChI=1/C15H11BrO3/c1-10(17)19-14-7-3-5-12(9-14)15(18)11-4-2-6-13(16)8-11/h2-9H,1H3

SMILES: CC(=O)Oc1cccc(c1)C(=O)c1cccc(c1)Br

3-Acetoxy-3'-bromobenzophenone

CAS: 890099-59-9

Formula: C₁₅H₁₁BrO₃

Molecular weight: 319.15

Ref: IN-DA0044QW

3-Acetoxy-3′-bromobenzophenone

CAS: 890099-59-9

Formula: C₁₅H₁₁BrO₃

Purity: 90.0%

Molecular weight: 319.154

Ref: 10-F201780