CAS 890099-60-2

[4-(4-phenoxybenzoyl)phenyl] acetate

Description:

[4-(4-phenoxybenzoyl)phenyl] acetate, with the CAS number 890099-60-2, is an organic compound characterized by its complex structure that includes both phenyl and acetate functional groups. This substance typically appears as a solid or crystalline material and is known for its potential applications in various fields, including pharmaceuticals and materials science. The presence of the phenoxy and phenyl groups suggests that it may exhibit interesting electronic properties and could participate in various chemical reactions, such as esterification or nucleophilic substitutions. Additionally, the compound may possess specific solubility characteristics, influencing its behavior in different solvents. Its molecular structure indicates potential for interactions with biological systems, which could be relevant for drug design or development. As with many organic compounds, safety and handling precautions should be observed, as it may pose risks such as irritation or toxicity depending on exposure levels. Overall, [4-(4-phenoxybenzoyl)phenyl] acetate represents a versatile compound with potential utility in both research and industrial applications.

Formula: C₂₁H₁₆O₄

InChI: InChI=1/C21H16O4/c1-15(22)24-19-11-7-16(8-12-19)21(23)17-9-13-20(14-10-17)25-18-5-3-2-4-6-18/h2-14H,1H3

SMILES: CC(=O)Oc1ccc(cc1)C(=O)c1ccc(cc1)Oc1ccccc1

4-Acetoxy-4'-phenoxybenzophenone

CAS: 890099-60-2

Formula: C₂₁H₁₆O₄

Molecular weight: 332.3493

Ref: IN-DA0044QV