CAS 890099-61-3

[3-(4-bromobenzoyl)phenyl] acetate

Description:

[3-(4-bromobenzoyl)phenyl] acetate is an organic compound characterized by its aromatic structure, which includes a phenyl ring substituted with a bromobenzoyl group and an acetate moiety. The presence of the bromine atom introduces significant electronegativity, influencing the compound's reactivity and physical properties. This compound typically exhibits a moderate to high melting point due to the strong intermolecular forces associated with its aromatic nature. It is likely to be soluble in organic solvents such as ethanol and acetone, while being less soluble in water due to its hydrophobic characteristics. The compound may display interesting biological activities, making it of interest in medicinal chemistry and material science. Its synthesis often involves acylation reactions, and it can be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. Overall, [3-(4-bromobenzoyl)phenyl] acetate serves as a valuable building block in organic synthesis and research applications.

Formula: C₁₅H₁₁BrO₃

InChI: InChI=1/C15H11BrO3/c1-10(17)19-14-4-2-3-12(9-14)15(18)11-5-7-13(16)8-6-11/h2-9H,1H3

SMILES: CC(=O)Oc1cccc(c1)C(=O)c1ccc(cc1)Br

3-Acetoxy-4'-bromobenzophenone

CAS: 890099-61-3

Formula: C₁₅H₁₁BrO₃

Molecular weight: 319.15

Ref: IN-DA0043L6

3-Acetoxy-4′-bromobenzophenone

CAS: 890099-61-3

Formula: C₁₅H₁₁BrO₃

Purity: 90.0%

Color and Shape: Liquid, Clear

Molecular weight: 319.154

Ref: 10-F201781