CAS 890099-62-4
:[4-(3-nitrobenzoyl)phenyl] acetate
Description:
[4-(3-Nitrobenzoyl)phenyl] acetate, with the CAS number 890099-62-4, is an organic compound characterized by its aromatic structure and functional groups. It features a phenyl ring substituted with an acetate group and a 3-nitrobenzoyl moiety, which contributes to its chemical reactivity and potential applications. The presence of the nitro group introduces electron-withdrawing characteristics, influencing the compound's reactivity and solubility in various solvents. This compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its synthesis often involves acylation reactions, and it may be utilized in organic synthesis, particularly in the development of pharmaceuticals or as an intermediate in chemical reactions. The compound's properties, such as melting point, boiling point, and solubility, can vary based on purity and environmental conditions. Safety data should be consulted, as nitro compounds can pose health risks, and appropriate handling procedures should be followed in laboratory settings.
Formula:C15H11NO5
InChI:InChI=1/C15H11NO5/c1-10(17)21-14-7-5-11(6-8-14)15(18)12-3-2-4-13(9-12)16(19)20/h2-9H,1H3
SMILES:CC(=O)Oc1ccc(cc1)C(=O)c1cccc(c1)N(=O)=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
