CymitQuimica logo

CAS 890099-64-6

:

[4-(Acetyloxy)phenyl](4-nitrophenyl)methanone

Description:
[4-(Acetyloxy)phenyl](4-nitrophenyl)methanone, with the CAS number 890099-64-6, is an organic compound characterized by its complex structure, which includes an acetyloxy group and a nitrophenyl moiety. This compound typically exhibits properties common to aromatic ketones, such as stability under standard conditions and potential reactivity due to the presence of functional groups. The acetyloxy group can influence the compound's solubility and reactivity, making it more polar compared to non-substituted phenyl ketones. The nitro group is known for its electron-withdrawing properties, which can affect the compound's electronic characteristics and reactivity in electrophilic aromatic substitution reactions. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry and material science. Its synthesis and applications could be explored in various fields, including pharmaceuticals and organic synthesis, where the manipulation of aromatic systems is crucial. Overall, [4-(Acetyloxy)phenyl](4-nitrophenyl)methanone represents a versatile structure with potential utility in various chemical applications.
Formula:C15H11NO5
InChI:InChI=1S/C15H11NO5/c1-10(17)21-14-8-4-12(5-9-14)15(18)11-2-6-13(7-3-11)16(19)20/h2-9H,1H3
InChI key:InChIKey=CDSYRIIULIOLFY-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(N(=O)=O)C=C1)C2=CC=C(OC(C)=O)C=C2
Synonyms:
  • [4-(Acetyloxy)phenyl](4-nitrophenyl)methanone
  • Methanone, [4-(acetyloxy)phenyl](4-nitrophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.