CAS 890099-67-9
:[3-(4-iodobenzoyl)phenyl] acetate
Description:
[3-(4-Iodobenzoyl)phenyl] acetate is an organic compound characterized by its aromatic structure, which includes a phenyl ring substituted with both an iodobenzoyl group and an acetate moiety. The presence of the iodine atom introduces notable properties, such as increased molecular weight and potential for enhanced reactivity in electrophilic substitution reactions. The compound features a carbonyl group from the benzoyl moiety, contributing to its reactivity and potential applications in organic synthesis. Additionally, the acetate group provides a site for hydrolysis, making the compound of interest in various chemical reactions. Its molecular structure suggests that it may exhibit interesting biological activities, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals or agrochemicals. The compound's solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in practical applications. Overall, [3-(4-iodobenzoyl)phenyl] acetate is a versatile compound with potential utility in both research and industrial contexts.
Formula:C15H11IO3
InChI:InChI=1/C15H11IO3/c1-10(17)19-14-4-2-3-12(9-14)15(18)11-5-7-13(16)8-6-11/h2-9H,1H3
SMILES:CC(=O)Oc1cccc(c1)C(=O)c1ccc(cc1)I
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
