CAS 890099-68-0

Methanone, [4-(acetyloxy)phenyl][4-(1-methylethoxy)phenyl]-

Description:

Methanone, [4-(acetyloxy)phenyl][4-(1-methylethoxy)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two aromatic phenyl rings. The presence of an acetyloxy group and an isopropoxy group on the phenyl rings contributes to its chemical reactivity and potential applications. This compound is likely to exhibit properties typical of ketones, such as being a polar solvent and having a relatively high boiling point compared to non-polar compounds. Its molecular structure suggests potential uses in organic synthesis, pharmaceuticals, or as an intermediate in the production of more complex molecules. Additionally, the presence of functional groups may influence its solubility in various solvents and its interaction with biological systems. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its reactivity and potential toxicity. Further studies would be necessary to fully elucidate its properties and applications in various fields.

Formula: C₁₈H₁₈O₄

InChI: InChI=1S/C18H18O4/c1-12(2)21-16-8-4-14(5-9-16)18(20)15-6-10-17(11-7-15)22-13(3)19/h4-12H,1-3H3

InChI key: InChIKey=XCQLCPYHKYSZKL-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(OC(C)C)C=C1)C2=CC=C(OC(C)=O)C=C2

Synonyms:

• 4-(4-Isopropoxybenzoyl)phenyl acetate
• 4-Acetoxy-4′-isopropoxybenzophenone
• Methanone, [4-(acetyloxy)phenyl][4-(1-methylethoxy)phenyl]-

4-Acetoxy-4'-isopropoxybenzophenone

CAS: 890099-68-0

Formula: C₁₈H₁₈O₄

Molecular weight: 298.3331

Ref: IN-DA0043L4