CAS 890099-69-1

[3-(3-cyanobenzoyl)phenyl] acetate

Description:

[3-(3-Cyanobenzoyl)phenyl] acetate, with the CAS number 890099-69-1, is an organic compound characterized by its aromatic structure and functional groups. It features a phenyl ring substituted with a cyanobenzoyl group and an acetate moiety, which contributes to its chemical reactivity and potential applications. The presence of the cyanobenzoyl group suggests that it may exhibit properties such as fluorescence or photochemical activity, making it of interest in materials science and organic synthesis. The acetate group can influence solubility and reactivity, allowing for various chemical transformations. This compound may also display biological activity, which could be explored in pharmaceutical research. Its molecular structure indicates potential interactions with biological targets, making it a candidate for further investigation in medicinal chemistry. Overall, [3-(3-cyanobenzoyl)phenyl] acetate is a versatile compound with unique characteristics that can be leveraged in various chemical and industrial applications.

Formula: C₁₆H₁₁NO₃

InChI: InChI=1/C16H11NO3/c1-11(18)20-15-7-3-6-14(9-15)16(19)13-5-2-4-12(8-13)10-17/h2-9H,1H3

SMILES: CC(=O)Oc1cccc(c1)C(=O)c1cccc(c1)C#N

3-Acetoxy-3'-cyanobenzophenone

CAS: 890099-69-1

Formula: C₁₆H₁₁NO₃

Molecular weight: 265.2634

Ref: IN-DA004445

3-Acetoxy-3′-cyanobenzophenone

CAS: 890099-69-1

Formula: C₁₆H₁₁NO₃

Purity: 90.0%

Molecular weight: 265.268

Ref: 10-F201785