CAS 890099-70-4

Methanone, [4-(acetyloxy)phenyl][4-(1,1-dimethylethyl)phenyl]-

Description:

Methanone, [4-(acetyloxy)phenyl][4-(1,1-dimethylethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two distinct phenyl rings. One of the phenyl groups is substituted with an acetyloxy group, enhancing its reactivity and solubility in organic solvents. The other phenyl ring is substituted with a tert-butyl group, which contributes to steric hindrance and influences the compound's physical properties, such as boiling point and melting point. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure suggests potential applications in materials science, particularly in the development of polymers or as a ligand in coordination chemistry. As with many organic compounds, its stability, reactivity, and interactions with other substances can be influenced by environmental factors such as temperature and pH. Safety data should be consulted for handling and storage, as it may pose health risks if not managed properly.

Formula: C₁₉H₂₀O₃

InChI: InChI=1S/C19H20O3/c1-13(20)22-17-11-7-15(8-12-17)18(21)14-5-9-16(10-6-14)19(2,3)4/h5-12H,1-4H3

InChI key: InChIKey=FEBKAADRHRUDOU-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(C(C)(C)C)C=C1)C2=CC=C(OC(C)=O)C=C2

Synonyms:

• Methanone, [4-(acetyloxy)phenyl][4-(1,1-dimethylethyl)phenyl]-

4-Acetoxy-4'-t-butylbenzophenone

CAS: 890099-70-4

Formula: C₁₉H₂₀O₃

Molecular weight: 296.3603

Ref: IN-DA0044O2