CAS 890099-71-5

[3-(4-cyanobenzoyl)phenyl] acetate

Description:

[3-(4-Cyanobenzoyl)phenyl] acetate, with the CAS number 890099-71-5, is an organic compound characterized by its aromatic structure and functional groups. It features a phenyl ring substituted with a cyanobenzoyl group and an acetate moiety, which contributes to its chemical reactivity and potential applications. The presence of the cyanobenzoyl group suggests that it may exhibit interesting electronic properties due to the electron-withdrawing nature of the cyano group, which can influence its behavior in various chemical reactions. Additionally, the acetate group can participate in esterification and hydrolysis reactions. This compound may be of interest in fields such as organic synthesis, materials science, or pharmaceuticals, where its unique structure could be leveraged for specific applications. Its solubility, stability, and reactivity would depend on the solvent and conditions used, making it essential to consider these factors in practical applications. Overall, [3-(4-cyanobenzoyl)phenyl] acetate represents a versatile compound with potential utility in various chemical contexts.

Formula: C₁₆H₁₁NO₃

InChI: InChI=1/C16H11NO3/c1-11(18)20-15-4-2-3-14(9-15)16(19)13-7-5-12(10-17)6-8-13/h2-9H,1H3

SMILES: CC(=O)Oc1cccc(c1)C(=O)c1ccc(cc1)C#N