CAS 890099-75-9

[3-(4-phenoxybenzoyl)phenyl] acetate

Description:

[3-(4-phenoxybenzoyl)phenyl] acetate, with the CAS number 890099-75-9, is an organic compound characterized by its complex structure, which includes a phenyl acetate moiety and a phenoxybenzoyl group. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for various chemical reactions due to the presence of functional groups. It is likely to be a solid at room temperature, with moderate solubility in organic solvents, reflecting its hydrophobic nature. The presence of the phenoxy and benzoyl groups suggests potential applications in fields such as pharmaceuticals, agrochemicals, or materials science, where it may serve as an intermediate or a building block for more complex molecules. Additionally, the compound may exhibit specific biological activities or interactions, making it of interest for further research in medicinal chemistry. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.

Formula: C₂₁H₁₆O₄

InChI: InChI=1/C21H16O4/c1-15(22)24-20-9-5-6-17(14-20)21(23)16-10-12-19(13-11-16)25-18-7-3-2-4-8-18/h2-14H,1H3

SMILES: CC(=O)Oc1cccc(c1)C(=O)c1ccc(cc1)Oc1ccccc1

3-Acetoxy-4'-phenoxybenzophenone

CAS: 890099-75-9

Formula: C₂₁H₁₆O₄

Molecular weight: 332.3493

Ref: IN-DA0043L2

3-Acetoxy-4'-phenoxybenzophenone

CAS: 890099-75-9

Purity: 90.0%

Molecular weight: 332.3550109863281

Ref: 10-F201788