CAS 890099-76-0
:[4-(4-pentylbenzoyl)phenyl] acetate
Description:
[4-(4-pentylbenzoyl)phenyl] acetate, with the CAS number 890099-76-0, is an organic compound characterized by its structure, which includes an acetate functional group and a phenyl ring substituted with a pentylbenzoyl moiety. This compound typically exhibits properties associated with aromatic compounds, such as stability and relatively low reactivity under standard conditions. It is likely to be a solid at room temperature, given the presence of long alkyl chains that can enhance its melting point. The presence of the acetate group suggests it may have moderate solubility in organic solvents while being less soluble in water. Additionally, the compound may exhibit interesting photophysical properties, making it potentially useful in applications such as organic electronics or as a precursor in the synthesis of more complex molecules. Its specific reactivity and interactions would depend on the functional groups present and the overall molecular structure, which can influence its behavior in various chemical environments.
Formula:C20H22O3
InChI:InChI=1/C20H22O3/c1-3-4-5-6-16-7-9-17(10-8-16)20(22)18-11-13-19(14-12-18)23-15(2)21/h7-14H,3-6H2,1-2H3
SMILES:CCCCCc1ccc(cc1)C(=O)c1ccc(cc1)OC(=O)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.