CymitQuimica logo

CAS 890099-77-1

:

[3-(3-nitrobenzoyl)phenyl] acetate

Description:
[3-(3-nitrobenzoyl)phenyl] acetate is an organic compound characterized by its aromatic structure, which includes a phenyl ring substituted with a nitro group and an acetate moiety. This compound typically exhibits a yellow to orange color due to the presence of the nitro group, which can also influence its reactivity and solubility. It is likely to be soluble in organic solvents such as ethanol and acetone, while being less soluble in water due to its hydrophobic aromatic components. The nitro group is known for its electron-withdrawing properties, which can affect the compound's reactivity in electrophilic aromatic substitution reactions. Additionally, the acetate group can participate in hydrolysis reactions under certain conditions, leading to the release of acetic acid. This compound may have applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, owing to its potential biological activity. Safety precautions should be taken when handling this substance, as nitro compounds can be hazardous.
Formula:C15H11NO5
InChI:InChI=1/C15H11NO5/c1-10(17)21-14-7-3-5-12(9-14)15(18)11-4-2-6-13(8-11)16(19)20/h2-9H,1H3
SMILES:CC(=O)Oc1cccc(c1)C(=O)c1cccc(c1)N(=O)=O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.