CymitQuimica logo

CAS 890099-80-6

:

[3-(4-nitrobenzoyl)phenyl] acetate

Description:
[3-(4-Nitrobenzoyl)phenyl] acetate is an organic compound characterized by its structure, which includes an acetate group and a nitro-substituted aromatic ring. This compound typically appears as a solid at room temperature and is soluble in organic solvents such as acetone and ethanol, but may have limited solubility in water due to its hydrophobic aromatic components. The presence of the nitro group introduces significant electron-withdrawing characteristics, which can influence the compound's reactivity and stability. It may exhibit properties such as moderate to high melting and boiling points, depending on its molecular interactions. Additionally, [3-(4-nitrobenzoyl)phenyl] acetate can be used in various applications, including as an intermediate in organic synthesis and in the development of pharmaceuticals or agrochemicals. Safety considerations should be taken into account, as compounds containing nitro groups can be hazardous and may require appropriate handling and storage measures. Overall, this compound exemplifies the diverse functionalities of aromatic esters in chemical research and industrial applications.
Formula:C15H11NO5
InChI:InChI=1/C15H11NO5/c1-10(17)21-14-4-2-3-12(9-14)15(18)11-5-7-13(8-6-11)16(19)20/h2-9H,1H3
SMILES:CC(=O)Oc1cccc(c1)C(=O)c1ccc(cc1)N(=O)=O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.