CymitQuimica logo

CAS 890099-82-8

:

[3-(4-isopropylbenzoyl)phenyl] acetate

Description:
[3-(4-Isopropylbenzoyl)phenyl] acetate, with the CAS number 890099-82-8, is an organic compound characterized by its structure, which includes an acetate group and a phenyl ring substituted with a 4-isopropylbenzoyl moiety. This compound typically exhibits properties common to aromatic esters, such as moderate volatility and solubility in organic solvents. It may possess a distinct aromatic odor due to the presence of the phenyl groups. The isopropyl substitution can influence its physical properties, such as melting and boiling points, as well as its reactivity. In terms of applications, compounds like this are often explored in fields such as organic synthesis, materials science, and potentially in pharmaceuticals, depending on their biological activity. Safety data sheets would provide essential information regarding handling, storage, and potential hazards associated with this compound, emphasizing the importance of proper laboratory practices when working with chemical substances.
Formula:C18H18O3
InChI:InChI=1/C18H18O3/c1-12(2)14-7-9-15(10-8-14)18(20)16-5-4-6-17(11-16)21-13(3)19/h4-12H,1-3H3
SMILES:CC(C)c1ccc(cc1)C(=O)c1cccc(c1)OC(=O)C
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.