CAS 890099-83-9
:[4-(4-ethoxybenzoyl)phenyl] acetate
Description:
[4-(4-Ethoxybenzoyl)phenyl] acetate, with the CAS number 890099-83-9, is an organic compound characterized by its ester functional group and aromatic structure. It features a phenyl ring substituted with an ethoxybenzoyl group and an acetate moiety, contributing to its potential applications in organic synthesis and materials science. The presence of the ethoxy group enhances its solubility in organic solvents, while the acetate group may influence its reactivity and interactions with other chemical species. This compound is likely to exhibit moderate to high stability under standard conditions, although specific stability and reactivity can depend on environmental factors such as temperature and pH. Its molecular structure suggests potential uses in pharmaceuticals, agrochemicals, or as a building block in the synthesis of more complex organic molecules. As with many organic compounds, safety data should be consulted to understand its handling, toxicity, and environmental impact. Overall, [4-(4-ethoxybenzoyl)phenyl] acetate represents a versatile compound within the realm of organic chemistry.
Formula:C17H16O4
InChI:InChI=1/C17H16O4/c1-3-20-15-8-4-13(5-9-15)17(19)14-6-10-16(11-7-14)21-12(2)18/h4-11H,3H2,1-2H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
